C9H10N2O — CID 131153081
5,6,7,8-tetrahydro-1,6-naphthyridine-5-carbaldehyde (PubChem CID 131153081) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-1,6-naphthyridine-5-carbaldehyde.
| Compound Name | 5,6,7,8-tetrahydro-1,6-naphthyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 131153081 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 5,6,7,8-tetrahydro-1,6-naphthyridine-5-carbaldehyde |
| SMILES | O=CC1NCCc2ncccc21 |
| InChI | InChI=1S/C9H10N2O/c12-6-9-7-2-1-4-10-8(7)3-5-11-9/h1-2,4,6,9,11H,3,5H2 |
| InChIKey | UDAONQGLWUURFJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|