C6H8N4O — CID 131154584
3-[(5-methyl-1,3,4-oxadiazol-2-yl)amino]propanenitrile (PubChem CID 131154584) has the molecular formula C6H8N4O and a molecular weight of 152.16 g/mol. Its IUPAC name is 3-[(5-methyl-1,3,4-oxadiazol-2-yl)amino]propanenitrile.
| Compound Name | 3-[(5-methyl-1,3,4-oxadiazol-2-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 131154584 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 3-[(5-methyl-1,3,4-oxadiazol-2-yl)amino]propanenitrile |
| SMILES | Cc1nnc(NCCC#N)o1 |
| InChI | InChI=1S/C6H8N4O/c1-5-9-10-6(11-5)8-4-2-3-7/h2,4H2,1H3,(H,8,10) |
| InChIKey | POAQAJRQWWYCOT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|