C6H8Cl2N4O — CID 131160011
5-chloro-2-methylpyrimidine-4-carbohydrazide;hydrochloride (PubChem CID 131160011) has the molecular formula C6H8Cl2N4O and a molecular weight of 223.06 g/mol. Its IUPAC name is 5-chloro-2-methylpyrimidine-4-carbohydrazide;hydrochloride.
| Compound Name | 5-chloro-2-methylpyrimidine-4-carbohydrazide;hydrochloride |
|---|---|
| PubChem CID | 131160011 |
| Molecular Formula | C6H8Cl2N4O |
| Molecular Weight | 223.06 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | 5-chloro-2-methylpyrimidine-4-carbohydrazide;hydrochloride |
| SMILES | Cc1ncc(Cl)c(C(=O)NN)n1.Cl |
| InChI | InChI=1S/C6H7ClN4O.ClH/c1-3-9-2-4(7)5(10-3)6(12)11-8;/h2H,8H2,1H3,(H,11,12);1H |
| InChIKey | BZXDQSYPJNPLDZ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.06 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|