C6H6Cl2N6O2 — CID 162717710
5,6-dichloropyrazine-2,3-dicarbohydrazide (PubChem CID 162717710) has the molecular formula C6H6Cl2N6O2 and a molecular weight of 265.06 g/mol. Its IUPAC name is 5,6-dichloropyrazine-2,3-dicarbohydrazide.
| Compound Name | 5,6-dichloropyrazine-2,3-dicarbohydrazide |
|---|---|
| PubChem CID | 162717710 |
| Molecular Formula | C6H6Cl2N6O2 |
| Molecular Weight | 265.06 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 5,6-dichloropyrazine-2,3-dicarbohydrazide |
| SMILES | NNC(=O)c1nc(Cl)c(Cl)nc1C(=O)NN |
| InChI | InChI=1S/C6H6Cl2N6O2/c7-3-4(8)12-2(6(16)14-10)1(11-3)5(15)13-9/h9-10H2,(H,13,15)(H,14,16) |
| InChIKey | OKWYYXBGBYFFIL-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.06 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|