C9H7N3O — CID 13117511
3-methylcyclohepta[e][1,2,4]triazin-7-one (PubChem CID 13117511) has the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-methylcyclohepta[e][1,2,4]triazin-7-one.
| Compound Name | 3-methylcyclohepta[e][1,2,4]triazin-7-one |
|---|---|
| PubChem CID | 13117511 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 3-methylcyclohepta[e][1,2,4]triazin-7-one |
| SMILES | Cc1nnc2ccc(=O)ccc2n1 |
| InChI | InChI=1S/C9H7N3O/c1-6-10-8-4-2-7(13)3-5-9(8)12-11-6/h2-5H,1H3 |
| InChIKey | NJXOOUROOXZSEF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |