About [4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol
[4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol (PubChem CID 131176674) has the molecular formula C7H11N3O3
and a molecular weight of 185.18 g/mol. Its IUPAC name is [4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol |
| PubChem CID | 131176674 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | [4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol |
| SMILES | OCC1CN(c2nnco2)CCO1 |
| InChI | InChI=1S/C7H11N3O3/c11-4-6-3-10(1-2-12-6)7-9-8-5-13-7/h5-6,11H,1-4H2 |
| InChIKey | WOINSUJJGVIKPV-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol?
The IUPAC name of [4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol (CID 131176674) is [4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol.
What is the SMILES notation for [4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol?
The canonical SMILES for [4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol is OCC1CN(c2nnco2)CCO1.
What is the InChIKey of [4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol?
The InChIKey is WOINSUJJGVIKPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O3/c11-4-6-3-10(1-2-12-6)7-9-8-5-13-7/h5-6,11H,1-4H2.
What are the key properties of [4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol?
[4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol has a molecular weight of 185.18 g/mol, XLogP of -0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3,4-oxadiazol-2-yl)morpholin-2-yl]methanol is sourced from PubChem (CID 131176674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).