C9H11ClOS2 — CID 131186478
(2-chlorothiophen-3-yl)-(thiolan-3-yl)methanol (PubChem CID 131186478) has the molecular formula C9H11ClOS2 and a molecular weight of 234.77 g/mol. Its IUPAC name is (2-chlorothiophen-3-yl)-(thiolan-3-yl)methanol.
| Compound Name | (2-chlorothiophen-3-yl)-(thiolan-3-yl)methanol |
|---|---|
| PubChem CID | 131186478 |
| Molecular Formula | C9H11ClOS2 |
| Molecular Weight | 234.77 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | (2-chlorothiophen-3-yl)-(thiolan-3-yl)methanol |
| SMILES | OC(c1ccsc1Cl)C1CCSC1 |
| InChI | InChI=1S/C9H11ClOS2/c10-9-7(2-4-13-9)8(11)6-1-3-12-5-6/h2,4,6,8,11H,1,3,5H2 |
| InChIKey | OQPBHXLGFZGCJS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.77 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |