C8H14N2O2 — CID 131203487
(2R)-N-(2-cyano-2-methylpropyl)-2-hydroxypropanamide (PubChem CID 131203487) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (2R)-N-(2-cyano-2-methylpropyl)-2-hydroxypropanamide.
| Compound Name | (2R)-N-(2-cyano-2-methylpropyl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 131203487 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (2R)-N-(2-cyano-2-methylpropyl)-2-hydroxypropanamide |
| SMILES | C[C@@H](O)C(=O)NCC(C)(C)C#N |
| InChI | InChI=1S/C8H14N2O2/c1-6(11)7(12)10-5-8(2,3)4-9/h6,11H,5H2,1-3H3,(H,10,12)/t6-/m1/s1 |
| InChIKey | JFJITTADHXFUPJ-ZCFIWIBFSA-N |
| XLogP | 0.03 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |