C9H10FN3O — CID 131203943
4-(2-fluoroethylamino)-6-methoxypyridine-3-carbonitrile (PubChem CID 131203943) has the molecular formula C9H10FN3O and a molecular weight of 195.20 g/mol. Its IUPAC name is 4-(2-fluoroethylamino)-6-methoxypyridine-3-carbonitrile.
| Compound Name | 4-(2-fluoroethylamino)-6-methoxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 131203943 |
| Molecular Formula | C9H10FN3O |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 4-(2-fluoroethylamino)-6-methoxypyridine-3-carbonitrile |
| SMILES | COc1cc(NCCF)c(C#N)cn1 |
| InChI | InChI=1S/C9H10FN3O/c1-14-9-4-8(12-3-2-10)7(5-11)6-13-9/h4,6H,2-3H2,1H3,(H,12,13) |
| InChIKey | LKCRYIMSNUGIDU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |