C17H14FN7O — CID 88868704
6-(5-cyano-2-methoxyanilino)-8-(2-fluoroethylamino)imidazo[1,2-b]pyridazine-3-carbonitrile (PubChem CID 88868704) has the molecular formula C17H14FN7O and a molecular weight of 351.35 g/mol. Its IUPAC name is 6-(5-cyano-2-methoxyanilino)-8-(2-fluoroethylamino)imidazo[1,2-b]pyridazine-3-carbonitrile.
| Compound Name | 6-(5-cyano-2-methoxyanilino)-8-(2-fluoroethylamino)imidazo[1,2-b]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 88868704 |
| Molecular Formula | C17H14FN7O |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 6-(5-cyano-2-methoxyanilino)-8-(2-fluoroethylamino)imidazo[1,2-b]pyridazine-3-carbonitrile |
| SMILES | COc1ccc(C#N)cc1Nc1cc(NCCF)c2ncc(C#N)n2n1 |
| InChI | InChI=1S/C17H14FN7O/c1-26-15-3-2-11(8-19)6-13(15)23-16-7-14(21-5-4-18)17-22-10-12(9-20)25(17)24-16/h2-3,6-7,10,21H,4-5H2,1H3,(H,23,24) |
| InChIKey | FUVLOXFNUNZIDX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|