C15H11N7O — CID 59313948
8-amino-6-(5-cyano-2-methoxyanilino)imidazo[1,2-b]pyridazine-3-carbonitrile (PubChem CID 59313948) has the molecular formula C15H11N7O and a molecular weight of 305.30 g/mol. Its IUPAC name is 8-amino-6-(5-cyano-2-methoxyanilino)imidazo[1,2-b]pyridazine-3-carbonitrile.
| Compound Name | 8-amino-6-(5-cyano-2-methoxyanilino)imidazo[1,2-b]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 59313948 |
| Molecular Formula | C15H11N7O |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 8-amino-6-(5-cyano-2-methoxyanilino)imidazo[1,2-b]pyridazine-3-carbonitrile |
| SMILES | COc1ccc(C#N)cc1Nc1cc(N)c2ncc(C#N)n2n1 |
| InChI | InChI=1S/C15H11N7O/c1-23-13-3-2-9(6-16)4-12(13)20-14-5-11(18)15-19-8-10(7-17)22(15)21-14/h2-5,8H,18H2,1H3,(H,20,21) |
| InChIKey | RUAIKBPURGEGIA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 125.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|