C11H14N4O3 — CID 175225504
[5-cyano-4-[[(2R)-1-methoxypropan-2-yl]amino]-2-pyridinyl] carbamate (PubChem CID 175225504) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is [5-cyano-4-[[(2R)-1-methoxypropan-2-yl]amino]-2-pyridinyl] carbamate.
| Compound Name | [5-cyano-4-[[(2R)-1-methoxypropan-2-yl]amino]-2-pyridinyl] carbamate |
|---|---|
| PubChem CID | 175225504 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [5-cyano-4-[[(2R)-1-methoxypropan-2-yl]amino]-2-pyridinyl] carbamate |
| SMILES | COC[C@@H](C)Nc1cc(OC(N)=O)ncc1C#N |
| InChI | InChI=1S/C11H14N4O3/c1-7(6-17-2)15-9-3-10(18-11(13)16)14-5-8(9)4-12/h3,5,7H,6H2,1-2H3,(H2,13,16)(H,14,15)/t7-/m1/s1 |
| InChIKey | UZWSVXPYBNPIEM-SSDOTTSWSA-N |
| XLogP | 0.86 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |