C10H14O2 — CID 131239626
(E)-4-[(1R,2R,3R)-2-acetyl-3-methylcyclopropyl]but-3-en-2-one (PubChem CID 131239626) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (E)-4-[(1R,2R,3R)-2-acetyl-3-methylcyclopropyl]but-3-en-2-one.
| Compound Name | (E)-4-[(1R,2R,3R)-2-acetyl-3-methylcyclopropyl]but-3-en-2-one |
|---|---|
| PubChem CID | 131239626 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (E)-4-[(1R,2R,3R)-2-acetyl-3-methylcyclopropyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/[C@@H]1[C@@H](C)[C@H]1C(C)=O |
| InChI | InChI=1S/C10H14O2/c1-6(11)4-5-9-7(2)10(9)8(3)12/h4-5,7,9-10H,1-3H3/b5-4+/t7-,9-,10+/m1/s1 |
| InChIKey | ADNDAPRXIIPWCD-NRXAELRXSA-N |
| XLogP | 1.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|