C11H12FNO3 — CID 131252377
(4R)-4-(5-fluoro-2-hydroxy-3-methylphenyl)-1,3-oxazinan-2-one (PubChem CID 131252377) has the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. Its IUPAC name is (4R)-4-(5-fluoro-2-hydroxy-3-methylphenyl)-1,3-oxazinan-2-one.
| Compound Name | (4R)-4-(5-fluoro-2-hydroxy-3-methylphenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 131252377 |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (4R)-4-(5-fluoro-2-hydroxy-3-methylphenyl)-1,3-oxazinan-2-one |
| SMILES | Cc1cc(F)cc([C@H]2CCOC(=O)N2)c1O |
| InChI | InChI=1S/C11H12FNO3/c1-6-4-7(12)5-8(10(6)14)9-2-3-16-11(15)13-9/h4-5,9,14H,2-3H2,1H3,(H,13,15)/t9-/m1/s1 |
| InChIKey | SUKVELDAJJFFMA-SECBINFHSA-N |
| XLogP | 2.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|