C21H44N3+ — CID 13127921
N,N,N',N'-tetrabutyl-1-pyrrolidin-1-ium-1-ylidenemethanediamine (PubChem CID 13127921) has the molecular formula C21H44N3+ and a molecular weight of 338.60 g/mol. Its IUPAC name is N,N,N',N'-tetrabutyl-1-pyrrolidin-1-ium-1-ylidenemethanediamine.
| Compound Name | N,N,N',N'-tetrabutyl-1-pyrrolidin-1-ium-1-ylidenemethanediamine |
|---|---|
| PubChem CID | 13127921 |
| Molecular Formula | C21H44N3+ |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 338.35 |
| IUPAC Name | N,N,N',N'-tetrabutyl-1-pyrrolidin-1-ium-1-ylidenemethanediamine |
| SMILES | CCCCN(CCCC)C(N(CCCC)CCCC)=[N+]1CCCC1 |
| InChI | InChI=1S/C21H44N3/c1-5-9-15-22(16-10-6-2)21(24-19-13-14-20-24)23(17-11-7-3)18-12-8-4/h5-20H2,1-4H3/q+1 |
| InChIKey | NBUPDZZIADESOK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|