About 10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one
10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one (PubChem CID 13133571) has the molecular formula C13H10ClN3O
and a molecular weight of 259.70 g/mol. Its IUPAC name is 10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one.
Molecular Properties
| Compound Name | 10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
| PubChem CID | 13133571 |
| Molecular Formula | C13H10ClN3O |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one |
| SMILES | Cc1ncc2c(n1)-c1cc(Cl)ccc1NC(=O)C2 |
| InChI | InChI=1S/C13H10ClN3O/c1-7-15-6-8-4-12(18)17-11-3-2-9(14)5-10(11)13(8)16-7/h2-3,5-6H,4H2,1H3,(H,17,18) |
| InChIKey | FBNCXUFOEYIGHJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one?
The IUPAC name of 10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one (CID 13133571) is 10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one.
What is the SMILES notation for 10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one?
The canonical SMILES for 10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one is Cc1ncc2c(n1)-c1cc(Cl)ccc1NC(=O)C2.
What is the InChIKey of 10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one?
The InChIKey is FBNCXUFOEYIGHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClN3O/c1-7-15-6-8-4-12(18)17-11-3-2-9(14)5-10(11)13(8)16-7/h2-3,5-6H,4H2,1H3,(H,17,18).
What are the key properties of 10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one?
10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one has a molecular weight of 259.70 g/mol, XLogP of 2.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-chloro-2-methyl-5,7-dihydropyrimido[5,4-d][1]benzazepin-6-one is sourced from PubChem (CID 13133571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).