C10H5ClN2O2 — CID 131374256
4-(2-chloroacetyl)-1,3-benzoxazole-2-carbonitrile (PubChem CID 131374256) has the molecular formula C10H5ClN2O2 and a molecular weight of 220.62 g/mol. Its IUPAC name is 4-(2-chloroacetyl)-1,3-benzoxazole-2-carbonitrile.
| Compound Name | 4-(2-chloroacetyl)-1,3-benzoxazole-2-carbonitrile |
|---|---|
| PubChem CID | 131374256 |
| Molecular Formula | C10H5ClN2O2 |
| Molecular Weight | 220.62 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | 4-(2-chloroacetyl)-1,3-benzoxazole-2-carbonitrile |
| SMILES | N#Cc1nc2c(C(=O)CCl)cccc2o1 |
| InChI | InChI=1S/C10H5ClN2O2/c11-4-7(14)6-2-1-3-8-10(6)13-9(5-12)15-8/h1-3H,4H2 |
| InChIKey | KUIFXFGQBRUEKW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.62 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|