About methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate
methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate (PubChem CID 131427405) has the molecular formula C9H8O4S
and a molecular weight of 212.23 g/mol. Its IUPAC name is methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate |
| PubChem CID | 131427405 |
| Molecular Formula | C9H8O4S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate |
| SMILES | COC(=O)c1cc2c(s1)COCC2=O |
| InChI | InChI=1S/C9H8O4S/c1-12-9(11)7-2-5-6(10)3-13-4-8(5)14-7/h2H,3-4H2,1H3 |
| InChIKey | YOUJSQPPCWHGMF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate?
The IUPAC name of methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate (CID 131427405) is methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate.
What is the SMILES notation for methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate?
The canonical SMILES for methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate is COC(=O)c1cc2c(s1)COCC2=O.
What is the InChIKey of methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate?
The InChIKey is YOUJSQPPCWHGMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4S/c1-12-9(11)7-2-5-6(10)3-13-4-8(5)14-7/h2H,3-4H2,1H3.
What are the key properties of methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate?
methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate has a molecular weight of 212.23 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate is sourced from PubChem (CID 131427405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).