C9H8O4S — CID 131427405
methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate (PubChem CID 131427405) has the molecular formula C9H8O4S and a molecular weight of 212.23 g/mol. Its IUPAC name is methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate.
| Compound Name | methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate |
|---|---|
| PubChem CID | 131427405 |
| Molecular Formula | C9H8O4S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | methyl 4-oxo-7H-thieno[2,3-c]pyran-2-carboxylate |
| SMILES | COC(=O)c1cc2c(s1)COCC2=O |
| InChI | InChI=1S/C9H8O4S/c1-12-9(11)7-2-5-6(10)3-13-4-8(5)14-7/h2H,3-4H2,1H3 |
| InChIKey | YOUJSQPPCWHGMF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |