About methyl 2-amino-3H-thieno[2,3-b][1,4]oxazine-6-carboxylate
methyl 2-amino-3H-thieno[2,3-b][1,4]oxazine-6-carboxylate (PubChem CID 70296510) has the molecular formula C8H8N2O3S
and a molecular weight of 212.23 g/mol. Its IUPAC name is methyl 2-amino-3H-thieno[2,3-b][1,4]oxazine-6-carboxylate.
Analyze methyl 2-amino-3H-thieno[2,3-b][1,4]oxazine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3H-thieno[2,3-b][1,4]oxazine-6-carboxylate?
The IUPAC name of methyl 2-amino-3H-thieno[2,3-b][1,4]oxazine-6-carboxylate (CID 70296510) is methyl 2-amino-3H-thieno[2,3-b][1,4]oxazine-6-carboxylate.
What is the SMILES notation for methyl 2-amino-3H-thieno[2,3-b][1,4]oxazine-6-carboxylate?
The canonical SMILES for methyl 2-amino-3H-thieno[2,3-b][1,4]oxazine-6-carboxylate is COC(=O)c1cc2c(s1)OCC(N)=N2.
What is the InChIKey of methyl 2-amino-3H-thieno[2,3-b][1,4]oxazine-6-carboxylate?
The InChIKey is AISYDMPXRDZTAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3S/c1-12-7(11)5-2-4-8(14-5)13-3-6(9)10-4/h2H,3H2,1H3,(H2,9,10).
What are the key properties of methyl 2-amino-3H-thieno[2,3-b][1,4]oxazine-6-carboxylate?
methyl 2-amino-3H-thieno[2,3-b][1,4]oxazine-6-carboxylate has a molecular weight of 212.23 g/mol, XLogP of 0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3H-thieno[2,3-b][1,4]oxazine-6-carboxylate is sourced from PubChem (CID 70296510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).