C17H28INO — CID 13143900
2,2-dimethyl-3-(4-methylphenyl)-5-pentyl-1,2-oxazolidin-2-ium iodide (PubChem CID 13143900) has the molecular formula C17H28INO and a molecular weight of 389.32 g/mol. Its IUPAC name is 2,2-dimethyl-3-(4-methylphenyl)-5-pentyl-1,2-oxazolidin-2-ium iodide.
| Compound Name | 2,2-dimethyl-3-(4-methylphenyl)-5-pentyl-1,2-oxazolidin-2-ium iodide |
|---|---|
| PubChem CID | 13143900 |
| Molecular Formula | C17H28INO |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2,2-dimethyl-3-(4-methylphenyl)-5-pentyl-1,2-oxazolidin-2-ium iodide |
| SMILES | CCCCCC1CC(c2ccc(C)cc2)[N+](C)(C)O1.[I-] |
| InChI | InChI=1S/C17H28NO.HI/c1-5-6-7-8-16-13-17(18(3,4)19-16)15-11-9-14(2)10-12-15;/h9-12,16-17H,5-8,13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | MSZLNRPNJOBYCA-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|