C22H30NP — CID 134344236
(2S,5S)-N-butyl-2,5-bis(4-methylphenyl)phospholan-1-amine (PubChem CID 134344236) has the molecular formula C22H30NP and a molecular weight of 339.46 g/mol. Its IUPAC name is (2S,5S)-N-butyl-2,5-bis(4-methylphenyl)phospholan-1-amine.
| Compound Name | (2S,5S)-N-butyl-2,5-bis(4-methylphenyl)phospholan-1-amine |
|---|---|
| PubChem CID | 134344236 |
| Molecular Formula | C22H30NP |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | (2S,5S)-N-butyl-2,5-bis(4-methylphenyl)phospholan-1-amine |
| SMILES | CCCCNP1[C@H](c2ccc(C)cc2)CC[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C22H30NP/c1-4-5-16-23-24-21(19-10-6-17(2)7-11-19)14-15-22(24)20-12-8-18(3)9-13-20/h6-13,21-23H,4-5,14-16H2,1-3H3/t21-,22-/m0/s1 |
| InChIKey | MJUCEUCVCPJFHC-VXKWHMMOSA-N |
| XLogP | 6.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|