C17H19N2O3+ — CID 13145315
3-(1,3-benzodioxol-5-ylmethyl)-2-methyl-5,6,7,8-tetrahydro-1H-cinnolin-2-ium-4-one (PubChem CID 13145315) has the molecular formula C17H19N2O3+ and a molecular weight of 299.35 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-2-methyl-5,6,7,8-tetrahydro-1H-cinnolin-2-ium-4-one.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-2-methyl-5,6,7,8-tetrahydro-1H-cinnolin-2-ium-4-one |
|---|---|
| PubChem CID | 13145315 |
| Molecular Formula | C17H19N2O3+ |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-2-methyl-5,6,7,8-tetrahydro-1H-cinnolin-2-ium-4-one |
| SMILES | C[n+]1[nH]c2c(c(=O)c1Cc1ccc3c(c1)OCO3)CCCC2 |
| InChI | InChI=1S/C17H18N2O3/c1-19-14(17(20)12-4-2-3-5-13(12)18-19)8-11-6-7-15-16(9-11)22-10-21-15/h6-7,9H,2-5,8,10H2,1H3/p+1 |
| InChIKey | LBQGJPSXFYDROK-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|