C15H22F2O6S — CID 13146455
[1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxy-3-methylbutan-2-yl] methanesulfonate (PubChem CID 13146455) has the molecular formula C15H22F2O6S and a molecular weight of 368.40 g/mol. Its IUPAC name is [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxy-3-methylbutan-2-yl] methanesulfonate.
| Compound Name | [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxy-3-methylbutan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 13146455 |
| Molecular Formula | C15H22F2O6S |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | [1-[4-(difluoromethoxy)phenyl]-1,1-dimethoxy-3-methylbutan-2-yl] methanesulfonate |
| SMILES | COC(OC)(c1ccc(OC(F)F)cc1)C(OS(C)(=O)=O)C(C)C |
| InChI | InChI=1S/C15H22F2O6S/c1-10(2)13(23-24(5,18)19)15(20-3,21-4)11-6-8-12(9-7-11)22-14(16)17/h6-10,13-14H,1-5H3 |
| InChIKey | LJEHJRLARFVHSX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|