C12H22O3S2 — CID 13150035
4-octylsulfanyl-1,1-dioxo-2,3-dihydrothiophen-3-ol (PubChem CID 13150035) has the molecular formula C12H22O3S2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 4-octylsulfanyl-1,1-dioxo-2,3-dihydrothiophen-3-ol.
| Compound Name | 4-octylsulfanyl-1,1-dioxo-2,3-dihydrothiophen-3-ol |
|---|---|
| PubChem CID | 13150035 |
| Molecular Formula | C12H22O3S2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 4-octylsulfanyl-1,1-dioxo-2,3-dihydrothiophen-3-ol |
| SMILES | CCCCCCCCSC1=CS(=O)(=O)CC1O |
| InChI | InChI=1S/C12H22O3S2/c1-2-3-4-5-6-7-8-16-12-10-17(14,15)9-11(12)13/h10-11,13H,2-9H2,1H3 |
| InChIKey | QZJPTRLRCHVKBX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|