About methyl 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carboxylate
methyl 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carboxylate (PubChem CID 131521240) has the molecular formula C8H5Cl2N3O2
and a molecular weight of 246.05 g/mol. Its IUPAC name is methyl 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carboxylate.
Analyze methyl 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carboxylate?
The IUPAC name of methyl 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carboxylate (CID 131521240) is methyl 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carboxylate.
What is the SMILES notation for methyl 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carboxylate?
The canonical SMILES for methyl 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carboxylate is COC(=O)c1ccc2c(Cl)nc(Cl)nn12.
What is the InChIKey of methyl 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carboxylate?
The InChIKey is UDHSFJIRQPVAKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2N3O2/c1-15-7(14)5-3-2-4-6(9)11-8(10)12-13(4)5/h2-3H,1H3.
What are the key properties of methyl 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carboxylate?
methyl 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carboxylate has a molecular weight of 246.05 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dichloropyrrolo[2,1-f][1,2,4]triazine-7-carboxylate is sourced from PubChem (CID 131521240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).