C12H8ClN3O2S — CID 59332124
methyl 2-(3-chloroindazol-1-yl)-1,3-thiazole-4-carboxylate (PubChem CID 59332124) has the molecular formula C12H8ClN3O2S and a molecular weight of 293.74 g/mol. Its IUPAC name is methyl 2-(3-chloroindazol-1-yl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(3-chloroindazol-1-yl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 59332124 |
| Molecular Formula | C12H8ClN3O2S |
| Molecular Weight | 293.74 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | methyl 2-(3-chloroindazol-1-yl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(-n2nc(Cl)c3ccccc32)n1 |
| InChI | InChI=1S/C12H8ClN3O2S/c1-18-11(17)8-6-19-12(14-8)16-9-5-3-2-4-7(9)10(13)15-16/h2-6H,1H3 |
| InChIKey | XSJLTXAKOKLGTO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |