About 2-bromo-6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole
2-bromo-6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 131526767) has the molecular formula C6H2BrF3N2S
and a molecular weight of 271.06 g/mol. Its IUPAC name is 2-bromo-6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole.
Analyze 2-bromo-6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole?
The IUPAC name of 2-bromo-6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole (CID 131526767) is 2-bromo-6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 2-bromo-6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 2-bromo-6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole is FC(F)(F)c1cn2cc(Br)sc2n1.
What is the InChIKey of 2-bromo-6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole?
The InChIKey is GZJJYWRCZOJFIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrF3N2S/c7-4-2-12-1-3(6(8,9)10)11-5(12)13-4/h1-2H.
What are the key properties of 2-bromo-6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole?
2-bromo-6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole has a molecular weight of 271.06 g/mol, XLogP of 3.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 131526767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).