C7H7BrN2S — CID 155822374
5-bromo-2,6-dimethylimidazo[2,1-b][1,3]thiazole (PubChem CID 155822374) has the molecular formula C7H7BrN2S and a molecular weight of 231.12 g/mol. Its IUPAC name is 5-bromo-2,6-dimethylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-bromo-2,6-dimethylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 155822374 |
| Molecular Formula | C7H7BrN2S |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | 5-bromo-2,6-dimethylimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1cn2c(Br)c(C)nc2s1 |
| InChI | InChI=1S/C7H7BrN2S/c1-4-3-10-6(8)5(2)9-7(10)11-4/h3H,1-2H3 |
| InChIKey | OCFQLWPRRIBZCT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |