C23H24N2O4 — CID 131636916
[(1S,10S,12S,19S)-10-acetyl-12-ethenyl-9-oxo-8,16-diazapentacyclo[10.6.1.01,10.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-4-yl] acetate (PubChem CID 131636916) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is [(1S,10S,12S,19S)-10-acetyl-12-ethenyl-9-oxo-8,16-diazapentacyclo[10.6.1.01,10.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-4-yl] acetate.
| Compound Name | [(1S,10S,12S,19S)-10-acetyl-12-ethenyl-9-oxo-8,16-diazapentacyclo[10.6.1.01,10.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-4-yl] acetate |
|---|---|
| PubChem CID | 131636916 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [(1S,10S,12S,19S)-10-acetyl-12-ethenyl-9-oxo-8,16-diazapentacyclo[10.6.1.01,10.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-4-yl] acetate |
| SMILES | C=C[C@]12C=CCN3CC[C@@]4(c5cc(OC(C)=O)ccc5NC(=O)[C@@]4(C(C)=O)C1)[C@@H]32 |
| InChI | InChI=1S/C23H24N2O4/c1-4-21-8-5-10-25-11-9-22(19(21)25)17-12-16(29-15(3)27)6-7-18(17)24-20(28)23(22,13-21)14(2)26/h4-8,12,19H,1,9-11,13H2,2-3H3,(H,24,28)/t19-,21-,22+,23-/m0/s1 |
| InChIKey | PENZOWKXIDTCFC-SNJCGAMXSA-N |
| XLogP | 2.60 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|