C23H37ClN2 — CID 131637532
1,3-bis(1-adamantyl)imidazolidine;hydrochloride (PubChem CID 131637532) has the molecular formula C23H37ClN2 and a molecular weight of 377.02 g/mol. Its IUPAC name is 1,3-bis(1-adamantyl)imidazolidine;hydrochloride.
| Compound Name | 1,3-bis(1-adamantyl)imidazolidine;hydrochloride |
|---|---|
| PubChem CID | 131637532 |
| Molecular Formula | C23H37ClN2 |
| Molecular Weight | 377.02 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 1,3-bis(1-adamantyl)imidazolidine;hydrochloride |
| SMILES | C1C2CC3CC1CC(N1CCN(C45CC6CC(CC(C6)C4)C5)C1)(C2)C3.Cl |
| InChI | InChI=1S/C23H36N2.ClH/c1-2-25(23-12-19-6-20(13-23)8-21(7-19)14-23)15-24(1)22-9-16-3-17(10-22)5-18(4-16)11-22;/h16-21H,1-15H2;1H |
| InChIKey | JTBOBRXTBCQEDC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.02 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |