C17H25NO3S — CID 131653054
[4a-(propan-2-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-thiophen-3-ylmethanone (PubChem CID 131653054) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is [4a-(propan-2-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-thiophen-3-ylmethanone.
| Compound Name | [4a-(propan-2-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 131653054 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [4a-(propan-2-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-thiophen-3-ylmethanone |
| SMILES | CC(C)OCC12CCCOC1CCN(C(=O)c1ccsc1)C2 |
| InChI | InChI=1S/C17H25NO3S/c1-13(2)21-12-17-6-3-8-20-15(17)4-7-18(11-17)16(19)14-5-9-22-10-14/h5,9-10,13,15H,3-4,6-8,11-12H2,1-2H3 |
| InChIKey | LAPUEBVKYADKKT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |