C17H18N4O4 — CID 131658871
4-nitro-3-(spiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-pyrrolidine]-1'-ylmethyl)phenol (PubChem CID 131658871) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 4-nitro-3-(spiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-pyrrolidine]-1'-ylmethyl)phenol.
| Compound Name | 4-nitro-3-(spiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-pyrrolidine]-1'-ylmethyl)phenol |
|---|---|
| PubChem CID | 131658871 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-nitro-3-(spiro[5,7-dihydropyrano[4,3-d]pyrimidine-8,3'-pyrrolidine]-1'-ylmethyl)phenol |
| SMILES | O=[N+]([O-])c1ccc(O)cc1CN1CCC2(COCc3cncnc32)C1 |
| InChI | InChI=1S/C17H18N4O4/c22-14-1-2-15(21(23)24)12(5-14)7-20-4-3-17(9-20)10-25-8-13-6-18-11-19-16(13)17/h1-2,5-6,11,22H,3-4,7-10H2 |
| InChIKey | JQGCTKYZUCROFJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|