C23H26ClN3O2 — CID 131666408
N-(2,6-dimethylphenyl)-2-[3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanimidate;hydrochloride (PubChem CID 131666408) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanimidate;hydrochloride.
| Compound Name | N-(2,6-dimethylphenyl)-2-[3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanimidate;hydrochloride |
|---|---|
| PubChem CID | 131666408 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]ethanimidate;hydrochloride |
| SMILES | COc1ccc(-c2c[n+](C/C([O-])=N/c3c(C)cccc3C)c3n2CCC3)cc1.Cl |
| InChI | InChI=1S/C23H25N3O2.ClH/c1-16-6-4-7-17(2)23(16)24-21(27)15-25-14-20(26-13-5-8-22(25)26)18-9-11-19(28-3)12-10-18;/h4,6-7,9-12,14H,5,8,13,15H2,1-3H3;1H |
| InChIKey | VQKAUUVQTUQYGV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|