C23H20ClFN4OS — CID 131666474
N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)ethanimidate;hydrochloride (PubChem CID 131666474) has the molecular formula C23H20ClFN4OS and a molecular weight of 454.96 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)ethanimidate;hydrochloride.
| Compound Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)ethanimidate;hydrochloride |
|---|---|
| PubChem CID | 131666474 |
| Molecular Formula | C23H20ClFN4OS |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)ethanimidate;hydrochloride |
| SMILES | Cl.[O-]C(C[n+]1cc(-c2ccccc2)n2c1CCC2)=Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C23H19FN4OS.ClH/c24-18-10-8-16(9-11-18)19-15-30-23(25-19)26-21(29)14-27-13-20(17-5-2-1-3-6-17)28-12-4-7-22(27)28;/h1-3,5-6,8-11,13,15H,4,7,12,14H2;1H |
| InChIKey | NGMZCLWYQZLTCP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|