C18H23NO4S — CID 131672811
cyclopropyl-(1,1-dioxo-4-phenylmethoxy-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-6-yl)methanone (PubChem CID 131672811) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is cyclopropyl-(1,1-dioxo-4-phenylmethoxy-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-6-yl)methanone.
| Compound Name | cyclopropyl-(1,1-dioxo-4-phenylmethoxy-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-6-yl)methanone |
|---|---|
| PubChem CID | 131672811 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | cyclopropyl-(1,1-dioxo-4-phenylmethoxy-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-6-yl)methanone |
| SMILES | O=C(C1CC1)N1CC2C(OCc3ccccc3)CCS(=O)(=O)C2C1 |
| InChI | InChI=1S/C18H23NO4S/c20-18(14-6-7-14)19-10-15-16(8-9-24(21,22)17(15)11-19)23-12-13-4-2-1-3-5-13/h1-5,14-17H,6-12H2 |
| InChIKey | CIARAKSMAUKGMO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |