C18H14O8 — CID 131673813
(E)-2-[6-(2-carboxyethenyl)-2,3-dihydroxyphenyl]-3-(3,4-dihydroxyphenyl)prop-2-enoic acid (PubChem CID 131673813) has the molecular formula C18H14O8 and a molecular weight of 358.30 g/mol. Its IUPAC name is (E)-2-[6-(2-carboxyethenyl)-2,3-dihydroxyphenyl]-3-(3,4-dihydroxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-[6-(2-carboxyethenyl)-2,3-dihydroxyphenyl]-3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 131673813 |
| Molecular Formula | C18H14O8 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | (E)-2-[6-(2-carboxyethenyl)-2,3-dihydroxyphenyl]-3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(O)c(O)c1/C(=C\c1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C18H14O8/c19-12-4-1-9(8-14(12)21)7-11(18(25)26)16-10(3-6-15(22)23)2-5-13(20)17(16)24/h1-8,19-21,24H,(H,22,23)(H,25,26)/b6-3?,11-7+ |
| InChIKey | OAHRXWZJURTMHG-MJTQWOBDSA-N |
| XLogP | 2.23 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|