C18H26N2O2 — CID 131680683
(3,5-dimethylphenyl)-[5-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]methanone (PubChem CID 131680683) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-[5-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]methanone.
| Compound Name | (3,5-dimethylphenyl)-[5-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]methanone |
|---|---|
| PubChem CID | 131680683 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (3,5-dimethylphenyl)-[5-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]methanone |
| SMILES | COCCN1CC2CCN(C(=O)c3cc(C)cc(C)c3)C2C1 |
| InChI | InChI=1S/C18H26N2O2/c1-13-8-14(2)10-16(9-13)18(21)20-5-4-15-11-19(6-7-22-3)12-17(15)20/h8-10,15,17H,4-7,11-12H2,1-3H3 |
| InChIKey | AMTCEUCMVYYSJS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |