C19H30N4O2 — CID 131682115
1-[(4aS,8R,8aS)-8-[methyl(propan-2-yl)amino]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-3-pyrimidin-5-ylpropan-1-one (PubChem CID 131682115) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-[(4aS,8R,8aS)-8-[methyl(propan-2-yl)amino]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-3-pyrimidin-5-ylpropan-1-one.
| Compound Name | 1-[(4aS,8R,8aS)-8-[methyl(propan-2-yl)amino]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-3-pyrimidin-5-ylpropan-1-one |
|---|---|
| PubChem CID | 131682115 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-[(4aS,8R,8aS)-8-[methyl(propan-2-yl)amino]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-3-pyrimidin-5-ylpropan-1-one |
| SMILES | CC(C)N(C)[C@@H]1CN(C(=O)CCc2cncnc2)C[C@@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C19H30N4O2/c1-14(2)22(3)17-12-23(11-16-5-4-8-25-19(16)17)18(24)7-6-15-9-20-13-21-10-15/h9-10,13-14,16-17,19H,4-8,11-12H2,1-3H3/t16-,17+,19-/m0/s1 |
| InChIKey | IFCSRFBLWYJKLN-SCTDSRPQSA-N |
| XLogP | 1.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |