C17H28N4O — CID 97364613
(4aS,8R,8aS)-N-methyl-6-propan-2-yl-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine (PubChem CID 97364613) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is (4aS,8R,8aS)-N-methyl-6-propan-2-yl-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine.
| Compound Name | (4aS,8R,8aS)-N-methyl-6-propan-2-yl-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine |
|---|---|
| PubChem CID | 97364613 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | (4aS,8R,8aS)-N-methyl-6-propan-2-yl-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine |
| SMILES | CC(C)N1C[C@@H]2CCCO[C@@H]2[C@H](N(C)Cc2cncnc2)C1 |
| InChI | InChI=1S/C17H28N4O/c1-13(2)21-10-15-5-4-6-22-17(15)16(11-21)20(3)9-14-7-18-12-19-8-14/h7-8,12-13,15-17H,4-6,9-11H2,1-3H3/t15-,16+,17-/m0/s1 |
| InChIKey | UHGDJPIOHGSDAN-BBWFWOEESA-N |
| XLogP | 1.80 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |