C19H30N4O2 — CID 97387597
(4aS,8R,8aS)-N-methyl-6-(oxan-4-yl)-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine (PubChem CID 97387597) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is (4aS,8R,8aS)-N-methyl-6-(oxan-4-yl)-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine.
| Compound Name | (4aS,8R,8aS)-N-methyl-6-(oxan-4-yl)-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine |
|---|---|
| PubChem CID | 97387597 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (4aS,8R,8aS)-N-methyl-6-(oxan-4-yl)-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine |
| SMILES | CN(Cc1cncnc1)[C@@H]1CN(C2CCOCC2)C[C@@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C19H30N4O2/c1-22(11-15-9-20-14-21-10-15)18-13-23(17-4-7-24-8-5-17)12-16-3-2-6-25-19(16)18/h9-10,14,16-19H,2-8,11-13H2,1H3/t16-,18+,19-/m0/s1 |
| InChIKey | WLNYASWENXNMJL-UHOSZYNNSA-N |
| XLogP | 1.57 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |