C18H27N5O2 — CID 131687894
8-(1-methylcyclohex-3-ene-1-carbonyl)-N-propan-2-yl-5,6,7,9-tetrahydro-[1,2,4]triazolo[1,5-a][1,4]diazepine-6-carboxamide (PubChem CID 131687894) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 8-(1-methylcyclohex-3-ene-1-carbonyl)-N-propan-2-yl-5,6,7,9-tetrahydro-[1,2,4]triazolo[1,5-a][1,4]diazepine-6-carboxamide.
| Compound Name | 8-(1-methylcyclohex-3-ene-1-carbonyl)-N-propan-2-yl-5,6,7,9-tetrahydro-[1,2,4]triazolo[1,5-a][1,4]diazepine-6-carboxamide |
|---|---|
| PubChem CID | 131687894 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 8-(1-methylcyclohex-3-ene-1-carbonyl)-N-propan-2-yl-5,6,7,9-tetrahydro-[1,2,4]triazolo[1,5-a][1,4]diazepine-6-carboxamide |
| SMILES | CC(C)NC(=O)C1CN(C(=O)C2(C)CC=CCC2)Cc2ncnn2C1 |
| InChI | InChI=1S/C18H27N5O2/c1-13(2)21-16(24)14-9-22(11-15-19-12-20-23(15)10-14)17(25)18(3)7-5-4-6-8-18/h4-5,12-14H,6-11H2,1-3H3,(H,21,24) |
| InChIKey | UABOSRIDZSSPCE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|