C18H23N5O3S — CID 131689039
(3S,4aS,8aR)-6-(1-methyl-1,2,4-triazole-3-carbonyl)-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide (PubChem CID 131689039) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is (3S,4aS,8aR)-6-(1-methyl-1,2,4-triazole-3-carbonyl)-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide.
| Compound Name | (3S,4aS,8aR)-6-(1-methyl-1,2,4-triazole-3-carbonyl)-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 131689039 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (3S,4aS,8aR)-6-(1-methyl-1,2,4-triazole-3-carbonyl)-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
| SMILES | Cn1cnc(C(=O)N2CC[C@H]3OC[C@@H](C(=O)NCc4cccs4)C[C@H]3C2)n1 |
| InChI | InChI=1S/C18H23N5O3S/c1-22-11-20-16(21-22)18(25)23-5-4-15-12(9-23)7-13(10-26-15)17(24)19-8-14-3-2-6-27-14/h2-3,6,11-13,15H,4-5,7-10H2,1H3,(H,19,24)/t12-,13-,15+/m0/s1 |
| InChIKey | QDERKTMIVGKZRL-KCQAQPDRSA-N |
| XLogP | 1.06 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |