C18H22N4O3S — CID 131689077
(3S,4aS,8aR)-6-(1H-pyrazole-5-carbonyl)-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide (PubChem CID 131689077) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is (3S,4aS,8aR)-6-(1H-pyrazole-5-carbonyl)-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide.
| Compound Name | (3S,4aS,8aR)-6-(1H-pyrazole-5-carbonyl)-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 131689077 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (3S,4aS,8aR)-6-(1H-pyrazole-5-carbonyl)-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
| SMILES | O=C(NCc1cccs1)[C@@H]1CO[C@@H]2CCN(C(=O)c3ccn[nH]3)C[C@@H]2C1 |
| InChI | InChI=1S/C18H22N4O3S/c23-17(19-9-14-2-1-7-26-14)13-8-12-10-22(6-4-16(12)25-11-13)18(24)15-3-5-20-21-15/h1-3,5,7,12-13,16H,4,6,8-11H2,(H,19,23)(H,20,21)/t12-,13-,16+/m0/s1 |
| InChIKey | AQYZOLHPRXXIDA-HEHGZKQESA-N |
| XLogP | 1.65 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |