C19H25F3N2O4S — CID 155828187
(3R,4aR,8aS)-6-prop-2-enyl-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155828187) has the molecular formula C19H25F3N2O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is (3R,4aR,8aS)-6-prop-2-enyl-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,4aR,8aS)-6-prop-2-enyl-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828187 |
| Molecular Formula | C19H25F3N2O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (3R,4aR,8aS)-6-prop-2-enyl-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | C=CCN1CC[C@@H]2OC[C@H](C(=O)NCc3cccs3)C[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N2O2S.C2HF3O2/c1-2-6-19-7-5-16-13(11-19)9-14(12-21-16)17(20)18-10-15-4-3-8-22-15;3-2(4,5)1(6)7/h2-4,8,13-14,16H,1,5-7,9-12H2,(H,18,20);(H,6,7)/t13-,14-,16+;/m1./s1 |
| InChIKey | DIVBEGIJWVULEM-ISNMTSCSSA-N |
| XLogP | 2.91 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|