About 6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane
6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane (PubChem CID 13168930) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 13168930 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane |
| SMILES | C=C1COC2(CCCCC2C)O1 |
| InChI | InChI=1S/C10H16O2/c1-8-5-3-4-6-10(8)11-7-9(2)12-10/h8H,2-7H2,1H3 |
| InChIKey | LGHNKJVVGFMPCC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane (CID 13168930) is 6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane is C=C1COC2(CCCCC2C)O1.
What is the InChIKey of 6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane?
The InChIKey is LGHNKJVVGFMPCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-8-5-3-4-6-10(8)11-7-9(2)12-10/h8H,2-7H2,1H3.
What are the key properties of 6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane?
6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane has a molecular weight of 168.24 g/mol, XLogP of 2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-methylidene-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 13168930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).