C16H24O2 — CID 132542790
(1S,6S,7R,8R,13R)-7-methyl-15-methylidene-14,16-dioxatetracyclo[11.2.1.01,6.08,13]hexadecane (PubChem CID 132542790) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1S,6S,7R,8R,13R)-7-methyl-15-methylidene-14,16-dioxatetracyclo[11.2.1.01,6.08,13]hexadecane.
| Compound Name | (1S,6S,7R,8R,13R)-7-methyl-15-methylidene-14,16-dioxatetracyclo[11.2.1.01,6.08,13]hexadecane |
|---|---|
| PubChem CID | 132542790 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1S,6S,7R,8R,13R)-7-methyl-15-methylidene-14,16-dioxatetracyclo[11.2.1.01,6.08,13]hexadecane |
| SMILES | C=C1O[C@@]23CCCC[C@@H]2[C@H](C)[C@@H]2CCCC[C@@]12O3 |
| InChI | InChI=1S/C16H24O2/c1-11-13-7-3-5-9-15(13)12(2)17-16(18-15)10-6-4-8-14(11)16/h11,13-14H,2-10H2,1H3/t11-,13+,14-,15-,16-/m1/s1 |
| InChIKey | ACTVPJIQVGCKAN-DPZJBDQQSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |