C14H21NO2 — CID 134110873
14,16-dioxatetracyclo[11.2.1.01,6.08,13]hexadecan-15-imine (PubChem CID 134110873) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 14,16-dioxatetracyclo[11.2.1.01,6.08,13]hexadecan-15-imine.
| Compound Name | 14,16-dioxatetracyclo[11.2.1.01,6.08,13]hexadecan-15-imine |
|---|---|
| PubChem CID | 134110873 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 14,16-dioxatetracyclo[11.2.1.01,6.08,13]hexadecan-15-imine |
| SMILES | [H]/N=C1\OC23CCCCC2CC2CCCCC12O3 |
| InChI | InChI=1S/C14H21NO2/c15-12-13-7-3-1-5-10(13)9-11-6-2-4-8-14(11,16-12)17-13/h10-11,15H,1-9H2/b15-12- |
| InChIKey | QGOZSYUMNQWTEW-QINSGFPZSA-N |
| XLogP | 3.23 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|