C14H21ClN4O4S — CID 131691460
1-[(4aR,9aR)-4-methylsulfonyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-2-(4-chloropyrazol-1-yl)ethanone (PubChem CID 131691460) has the molecular formula C14H21ClN4O4S and a molecular weight of 376.87 g/mol. Its IUPAC name is 1-[(4aR,9aR)-4-methylsulfonyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-2-(4-chloropyrazol-1-yl)ethanone.
| Compound Name | 1-[(4aR,9aR)-4-methylsulfonyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-2-(4-chloropyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 131691460 |
| Molecular Formula | C14H21ClN4O4S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1-[(4aR,9aR)-4-methylsulfonyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-2-(4-chloropyrazol-1-yl)ethanone |
| SMILES | CS(=O)(=O)N1CCO[C@@H]2CCN(C(=O)Cn3cc(Cl)cn3)CC[C@H]21 |
| InChI | InChI=1S/C14H21ClN4O4S/c1-24(21,22)19-6-7-23-13-3-5-17(4-2-12(13)19)14(20)10-18-9-11(15)8-16-18/h8-9,12-13H,2-7,10H2,1H3/t12-,13-/m1/s1 |
| InChIKey | FMUQVLKHJQDKNS-CHWSQXEVSA-N |
| XLogP | 0.19 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |