C12H18F3N3O4S — CID 131703747
3-methyl-1-[1-(3,3,3-trifluoropropylsulfonyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 131703747) has the molecular formula C12H18F3N3O4S and a molecular weight of 357.35 g/mol. Its IUPAC name is 3-methyl-1-[1-(3,3,3-trifluoropropylsulfonyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 3-methyl-1-[1-(3,3,3-trifluoropropylsulfonyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 131703747 |
| Molecular Formula | C12H18F3N3O4S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 3-methyl-1-[1-(3,3,3-trifluoropropylsulfonyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)CN(C2CCN(S(=O)(=O)CCC(F)(F)F)CC2)C1=O |
| InChI | InChI=1S/C12H18F3N3O4S/c1-16-10(19)8-18(11(16)20)9-2-5-17(6-3-9)23(21,22)7-4-12(13,14)15/h9H,2-8H2,1H3 |
| InChIKey | XQTUJIXREDGWGG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|