C10H13Cl2N3 — CID 131711526
5-(chloromethyl)-1-ethyl-3-methylpyrazolo[5,4-b]pyridine;hydrochloride (PubChem CID 131711526) has the molecular formula C10H13Cl2N3 and a molecular weight of 246.14 g/mol. Its IUPAC name is 5-(chloromethyl)-1-ethyl-3-methylpyrazolo[5,4-b]pyridine;hydrochloride.
| Compound Name | 5-(chloromethyl)-1-ethyl-3-methylpyrazolo[5,4-b]pyridine;hydrochloride |
|---|---|
| PubChem CID | 131711526 |
| Molecular Formula | C10H13Cl2N3 |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 5-(chloromethyl)-1-ethyl-3-methylpyrazolo[5,4-b]pyridine;hydrochloride |
| SMILES | CCn1nc(C)c2cc(CCl)cnc21.Cl |
| InChI | InChI=1S/C10H12ClN3.ClH/c1-3-14-10-9(7(2)13-14)4-8(5-11)6-12-10;/h4,6H,3,5H2,1-2H3;1H |
| InChIKey | QADONDWZGBAUOG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|